About 1-[[1-(2-phenylethyl)tetrazol-5-yl]methyl]-3,4-dihydro-2H-quinoline;hydrochloride
1-[[1-(2-phenylethyl)tetrazol-5-yl]methyl]-3,4-dihydro-2H-quinoline;hydrochloride (PubChem CID 6603629) has the molecular formula C19H22ClN5
and a molecular weight of 355.87 g/mol. Its IUPAC name is 1-[[1-(2-phenylethyl)tetrazol-5-yl]methyl]-3,4-dihydro-2H-quinoline;hydrochloride.
Molecular Properties
| Compound Name | 1-[[1-(2-phenylethyl)tetrazol-5-yl]methyl]-3,4-dihydro-2H-quinoline;hydrochloride |
| PubChem CID | 6603629 |
| Molecular Formula | C19H22ClN5 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 1-[[1-(2-phenylethyl)tetrazol-5-yl]methyl]-3,4-dihydro-2H-quinoline;hydrochloride |
| SMILES | Cl.c1ccc(CCn2nnnc2CN2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C19H21N5.ClH/c1-2-7-16(8-3-1)12-14-24-19(20-21-22-24)15-23-13-6-10-17-9-4-5-11-18(17)23;/h1-5,7-9,11H,6,10,12-15H2;1H |
| InChIKey | CVMIBKDJNCGJAX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[1-(2-phenylethyl)tetrazol-5-yl]methyl]-3,4-dihydro-2H-quinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[1-(2-phenylethyl)tetrazol-5-yl]methyl]-3,4-dihydro-2H-quinoline;hydrochloride?
The IUPAC name of 1-[[1-(2-phenylethyl)tetrazol-5-yl]methyl]-3,4-dihydro-2H-quinoline;hydrochloride (CID 6603629) is 1-[[1-(2-phenylethyl)tetrazol-5-yl]methyl]-3,4-dihydro-2H-quinoline;hydrochloride.
What is the SMILES notation for 1-[[1-(2-phenylethyl)tetrazol-5-yl]methyl]-3,4-dihydro-2H-quinoline;hydrochloride?
The canonical SMILES for 1-[[1-(2-phenylethyl)tetrazol-5-yl]methyl]-3,4-dihydro-2H-quinoline;hydrochloride is Cl.c1ccc(CCn2nnnc2CN2CCCc3ccccc32)cc1.
What is the InChIKey of 1-[[1-(2-phenylethyl)tetrazol-5-yl]methyl]-3,4-dihydro-2H-quinoline;hydrochloride?
The InChIKey is CVMIBKDJNCGJAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N5.ClH/c1-2-7-16(8-3-1)12-14-24-19(20-21-22-24)15-23-13-6-10-17-9-4-5-11-18(17)23;/h1-5,7-9,11H,6,10,12-15H2;1H.
What are the key properties of 1-[[1-(2-phenylethyl)tetrazol-5-yl]methyl]-3,4-dihydro-2H-quinoline;hydrochloride?
1-[[1-(2-phenylethyl)tetrazol-5-yl]methyl]-3,4-dihydro-2H-quinoline;hydrochloride has a molecular weight of 355.87 g/mol, XLogP of 3.29, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[1-(2-phenylethyl)tetrazol-5-yl]methyl]-3,4-dihydro-2H-quinoline;hydrochloride is sourced from PubChem (CID 6603629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).