About (Z)-4-aminobut-2-enoic acid
(Z)-4-aminobut-2-enoic acid (PubChem CID 6603697) has the molecular formula C4H7NO2
and a molecular weight of 101.10 g/mol. Its IUPAC name is (Z)-4-aminobut-2-enoic acid.
Molecular Properties
| Compound Name | (Z)-4-aminobut-2-enoic acid |
| PubChem CID | 6603697 |
| Molecular Formula | C4H7NO2 |
| Molecular Weight | 101.10 g/mol |
| Exact Mass | 101.05 |
| IUPAC Name | (Z)-4-aminobut-2-enoic acid |
| SMILES | NC/C=C\C(=O)O |
| InChI | InChI=1S/C4H7NO2/c5-3-1-2-4(6)7/h1-2H,3,5H2,(H,6,7)/b2-1- |
| InChIKey | FMKJUUQOYOHLTF-UPHRSURJSA-N |
| XLogP | -0.41 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.10 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-aminobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-aminobut-2-enoic acid?
The IUPAC name of (Z)-4-aminobut-2-enoic acid (CID 6603697) is (Z)-4-aminobut-2-enoic acid.
What is the SMILES notation for (Z)-4-aminobut-2-enoic acid?
The canonical SMILES for (Z)-4-aminobut-2-enoic acid is NC/C=C\C(=O)O.
What is the InChIKey of (Z)-4-aminobut-2-enoic acid?
The InChIKey is FMKJUUQOYOHLTF-UPHRSURJSA-N. The full InChI is InChI=1S/C4H7NO2/c5-3-1-2-4(6)7/h1-2H,3,5H2,(H,6,7)/b2-1-.
What are the key properties of (Z)-4-aminobut-2-enoic acid?
(Z)-4-aminobut-2-enoic acid has a molecular weight of 101.10 g/mol, XLogP of -0.41, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-aminobut-2-enoic acid is sourced from PubChem (CID 6603697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).