About (2S)-2-[[(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid
(2S)-2-[[(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid (PubChem CID 6603747) has the molecular formula C16H24N2O4
and a molecular weight of 308.38 g/mol. Its IUPAC name is (2S)-2-[[(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid.
Molecular Properties
| Compound Name | (2S)-2-[[(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid |
| PubChem CID | 6603747 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | (2S)-2-[[(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](O)[C@@H](N)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H24N2O4/c1-10(2)8-13(16(21)22)18-15(20)14(19)12(17)9-11-6-4-3-5-7-11/h3-7,10,12-14,19H,8-9,17H2,1-2H3,(H,18,20)(H,21,22)/t12-,13-,14-/m0/s1 |
| InChIKey | VGGGPCQERPFHOB-IHRRRGAJSA-N |
| XLogP | 0.53 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-[[(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid?
The IUPAC name of (2S)-2-[[(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid (CID 6603747) is (2S)-2-[[(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid.
What is the SMILES notation for (2S)-2-[[(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid?
The canonical SMILES for (2S)-2-[[(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid is CC(C)C[C@H](NC(=O)[C@@H](O)[C@@H](N)Cc1ccccc1)C(=O)O.
What is the InChIKey of (2S)-2-[[(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid?
The InChIKey is VGGGPCQERPFHOB-IHRRRGAJSA-N. The full InChI is InChI=1S/C16H24N2O4/c1-10(2)8-13(16(21)22)18-15(20)14(19)12(17)9-11-6-4-3-5-7-11/h3-7,10,12-14,19H,8-9,17H2,1-2H3,(H,18,20)(H,21,22)/t12-,13-,14-/m0/s1.
What are the key properties of (2S)-2-[[(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid?
(2S)-2-[[(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid has a molecular weight of 308.38 g/mol, XLogP of 0.53, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoyl]amino]-4-methylpentanoic acid is sourced from PubChem (CID 6603747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).