C10H13NO2 — CID 6603796
(6R)-6-amino-5,6,7,8-tetrahydronaphthalene-2,3-diol (PubChem CID 6603796) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (6R)-6-amino-5,6,7,8-tetrahydronaphthalene-2,3-diol.
| Compound Name | (6R)-6-amino-5,6,7,8-tetrahydronaphthalene-2,3-diol |
|---|---|
| PubChem CID | 6603796 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (6R)-6-amino-5,6,7,8-tetrahydronaphthalene-2,3-diol |
| SMILES | N[C@@H]1CCc2cc(O)c(O)cc2C1 |
| InChI | InChI=1S/C10H13NO2/c11-8-2-1-6-4-9(12)10(13)5-7(6)3-8/h4-5,8,12-13H,1-3,11H2/t8-/m1/s1 |
| InChIKey | ASXGAOFCKGHGMF-MRVPVSSYSA-N |
| XLogP | 0.91 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|