C20H19F6NO — CID 6603898
(2S,3R)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidine (PubChem CID 6603898) has the molecular formula C20H19F6NO and a molecular weight of 403.37 g/mol. Its IUPAC name is (2S,3R)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidine.
| Compound Name | (2S,3R)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidine |
|---|---|
| PubChem CID | 6603898 |
| Molecular Formula | C20H19F6NO |
| Molecular Weight | 403.37 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | (2S,3R)-3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-phenylpiperidine |
| SMILES | FC(F)(F)c1cc(CO[C@@H]2CCCNC2c2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F6NO/c21-19(22,23)15-9-13(10-16(11-15)20(24,25)26)12-28-17-7-4-8-27-18(17)14-5-2-1-3-6-14/h1-3,5-6,9-11,17-18,27H,4,7-8,12H2/t17-,18?/m1/s1 |
| InChIKey | FCDRFVCGMLUYPG-QNSVNVJESA-N |
| XLogP | 5.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.37 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |