About 1-amino-3-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-methylpropan-2-ol
1-amino-3-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-methylpropan-2-ol (PubChem CID 66039829) has the molecular formula C9H16BrN3O
and a molecular weight of 262.15 g/mol. Its IUPAC name is 1-amino-3-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-methylpropan-2-ol.
Molecular Properties
| Compound Name | 1-amino-3-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-methylpropan-2-ol |
| PubChem CID | 66039829 |
| Molecular Formula | C9H16BrN3O |
| Molecular Weight | 262.15 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 1-amino-3-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-methylpropan-2-ol |
| SMILES | Cc1nn(C)c(CC(C)(O)CN)c1Br |
| InChI | InChI=1S/C9H16BrN3O/c1-6-8(10)7(13(3)12-6)4-9(2,14)5-11/h14H,4-5,11H2,1-3H3 |
| InChIKey | BPVLIPJFCNRQHQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.15 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-amino-3-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-methylpropan-2-ol?
The IUPAC name of 1-amino-3-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-methylpropan-2-ol (CID 66039829) is 1-amino-3-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-methylpropan-2-ol.
What is the SMILES notation for 1-amino-3-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-methylpropan-2-ol?
The canonical SMILES for 1-amino-3-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-methylpropan-2-ol is Cc1nn(C)c(CC(C)(O)CN)c1Br.
What is the InChIKey of 1-amino-3-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-methylpropan-2-ol?
The InChIKey is BPVLIPJFCNRQHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16BrN3O/c1-6-8(10)7(13(3)12-6)4-9(2,14)5-11/h14H,4-5,11H2,1-3H3.
What are the key properties of 1-amino-3-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-methylpropan-2-ol?
1-amino-3-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-methylpropan-2-ol has a molecular weight of 262.15 g/mol, XLogP of 0.74, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-(4-bromo-1,3-dimethylpyrazol-5-yl)-2-methylpropan-2-ol is sourced from PubChem (CID 66039829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).