About 1-(1-methyl-2,3-dihydroindol-5-yl)-3-pyridin-3-ylurea
1-(1-methyl-2,3-dihydroindol-5-yl)-3-pyridin-3-ylurea (PubChem CID 6603998) has the molecular formula C15H16N4O
and a molecular weight of 268.32 g/mol. Its IUPAC name is 1-(1-methyl-2,3-dihydroindol-5-yl)-3-pyridin-3-ylurea.
Molecular Properties
| Compound Name | 1-(1-methyl-2,3-dihydroindol-5-yl)-3-pyridin-3-ylurea |
| PubChem CID | 6603998 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 1-(1-methyl-2,3-dihydroindol-5-yl)-3-pyridin-3-ylurea |
| SMILES | CN1CCc2cc(NC(=O)Nc3cccnc3)ccc21 |
| InChI | InChI=1S/C15H16N4O/c1-19-8-6-11-9-12(4-5-14(11)19)17-15(20)18-13-3-2-7-16-10-13/h2-5,7,9-10H,6,8H2,1H3,(H2,17,18,20) |
| InChIKey | AVGWYMLCNKIXFE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-methyl-2,3-dihydroindol-5-yl)-3-pyridin-3-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methyl-2,3-dihydroindol-5-yl)-3-pyridin-3-ylurea?
The IUPAC name of 1-(1-methyl-2,3-dihydroindol-5-yl)-3-pyridin-3-ylurea (CID 6603998) is 1-(1-methyl-2,3-dihydroindol-5-yl)-3-pyridin-3-ylurea.
What is the SMILES notation for 1-(1-methyl-2,3-dihydroindol-5-yl)-3-pyridin-3-ylurea?
The canonical SMILES for 1-(1-methyl-2,3-dihydroindol-5-yl)-3-pyridin-3-ylurea is CN1CCc2cc(NC(=O)Nc3cccnc3)ccc21.
What is the InChIKey of 1-(1-methyl-2,3-dihydroindol-5-yl)-3-pyridin-3-ylurea?
The InChIKey is AVGWYMLCNKIXFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4O/c1-19-8-6-11-9-12(4-5-14(11)19)17-15(20)18-13-3-2-7-16-10-13/h2-5,7,9-10H,6,8H2,1H3,(H2,17,18,20).
What are the key properties of 1-(1-methyl-2,3-dihydroindol-5-yl)-3-pyridin-3-ylurea?
1-(1-methyl-2,3-dihydroindol-5-yl)-3-pyridin-3-ylurea has a molecular weight of 268.32 g/mol, XLogP of 2.72, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methyl-2,3-dihydroindol-5-yl)-3-pyridin-3-ylurea is sourced from PubChem (CID 6603998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).