C12H17BrFNO — CID 66040311
1-(4-bromo-2-fluorophenyl)-3-(ethylamino)-2-methylpropan-2-ol (PubChem CID 66040311) has the molecular formula C12H17BrFNO and a molecular weight of 290.18 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-(ethylamino)-2-methylpropan-2-ol.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-(ethylamino)-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 66040311 |
| Molecular Formula | C12H17BrFNO |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-(ethylamino)-2-methylpropan-2-ol |
| SMILES | CCNCC(C)(O)Cc1ccc(Br)cc1F |
| InChI | InChI=1S/C12H17BrFNO/c1-3-15-8-12(2,16)7-9-4-5-10(13)6-11(9)14/h4-6,15-16H,3,7-8H2,1-2H3 |
| InChIKey | NBGMOUAHQQOIQD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |