3-[5-(1,1-dioxothiolan-3-yl)tetrazol-1-yl]propanoic acid

C8H12N4O4S — CID 66041011

IUPAC3-[5-(1,1-dioxothiolan-3-yl)tetrazol-1-yl]propanoic acid
SMILESO=C(O)CCn1nnnc1C1CCS(=O)(=O)C1
InChIInChI=1S/C8H12N4O4S/c13-7(14)1-3-12-8(9-10-11-12)6-2-4-17(15,16)5-6/h6H,1-5H2,(H,13,14)
InChIKeyLHSYSRMNGOAQRQ-UHFFFAOYSA-N
MW260.27 g/mol
LogP-0.95
Rot. Bonds4

About 3-[5-(1,1-dioxothiolan-3-yl)tetrazol-1-yl]propanoic acid

3-[5-(1,1-dioxothiolan-3-yl)tetrazol-1-yl]propanoic acid (PubChem CID 66041011) has the molecular formula C8H12N4O4S and a molecular weight of 260.27 g/mol. Its IUPAC name is 3-[5-(1,1-dioxothiolan-3-yl)tetrazol-1-yl]propanoic acid.

Molecular Properties

Compound Name3-[5-(1,1-dioxothiolan-3-yl)tetrazol-1-yl]propanoic acid
PubChem CID66041011
Molecular FormulaC8H12N4O4S
Molecular Weight260.27 g/mol
Exact Mass260.06
IUPAC Name3-[5-(1,1-dioxothiolan-3-yl)tetrazol-1-yl]propanoic acid
SMILESO=C(O)CCn1nnnc1C1CCS(=O)(=O)C1
InChIInChI=1S/C8H12N4O4S/c13-7(14)1-3-12-8(9-10-11-12)6-2-4-17(15,16)5-6/h6H,1-5H2,(H,13,14)
InChIKeyLHSYSRMNGOAQRQ-UHFFFAOYSA-N
XLogP-0.95
TPSA115.04 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.27
LogP ≤ 5-0.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Analyze 3-[5-(1,1-dioxothiolan-3-yl)tetrazol-1-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[5-(1,1-dioxothiolan-3-yl)tetrazol-1-yl]propanoic acid?
The IUPAC name of 3-[5-(1,1-dioxothiolan-3-yl)tetrazol-1-yl]propanoic acid (CID 66041011) is 3-[5-(1,1-dioxothiolan-3-yl)tetrazol-1-yl]propanoic acid.
What is the SMILES notation for 3-[5-(1,1-dioxothiolan-3-yl)tetrazol-1-yl]propanoic acid?
The canonical SMILES for 3-[5-(1,1-dioxothiolan-3-yl)tetrazol-1-yl]propanoic acid is O=C(O)CCn1nnnc1C1CCS(=O)(=O)C1.
What is the InChIKey of 3-[5-(1,1-dioxothiolan-3-yl)tetrazol-1-yl]propanoic acid?
The InChIKey is LHSYSRMNGOAQRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O4S/c13-7(14)1-3-12-8(9-10-11-12)6-2-4-17(15,16)5-6/h6H,1-5H2,(H,13,14).
What are the key properties of 3-[5-(1,1-dioxothiolan-3-yl)tetrazol-1-yl]propanoic acid?
3-[5-(1,1-dioxothiolan-3-yl)tetrazol-1-yl]propanoic acid has a molecular weight of 260.27 g/mol, XLogP of -0.95, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(1,1-dioxothiolan-3-yl)tetrazol-1-yl]propanoic acid is sourced from PubChem (CID 66041011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).