C9H10N6O2 — CID 66041776
2-[5-(5-methylpyrazin-2-yl)tetrazol-1-yl]propanoic acid (PubChem CID 66041776) has the molecular formula C9H10N6O2 and a molecular weight of 234.22 g/mol. Its IUPAC name is 2-[5-(5-methylpyrazin-2-yl)tetrazol-1-yl]propanoic acid.
| Compound Name | 2-[5-(5-methylpyrazin-2-yl)tetrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 66041776 |
| Molecular Formula | C9H10N6O2 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 2-[5-(5-methylpyrazin-2-yl)tetrazol-1-yl]propanoic acid |
| SMILES | Cc1cnc(-c2nnnn2C(C)C(=O)O)cn1 |
| InChI | InChI=1S/C9H10N6O2/c1-5-3-11-7(4-10-5)8-12-13-14-15(8)6(2)9(16)17/h3-4,6H,1-2H3,(H,16,17) |
| InChIKey | XLVQCBUENDLQJA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |