About (1R)-2,2,2-trichloro-1-dimethoxyphosphorylethanol
(1R)-2,2,2-trichloro-1-dimethoxyphosphorylethanol (PubChem CID 6604183) has the molecular formula C4H8Cl3O4P
and a molecular weight of 257.44 g/mol. Its IUPAC name is (1R)-2,2,2-trichloro-1-dimethoxyphosphorylethanol.
Molecular Properties
| Compound Name | (1R)-2,2,2-trichloro-1-dimethoxyphosphorylethanol |
| PubChem CID | 6604183 |
| Molecular Formula | C4H8Cl3O4P |
| Molecular Weight | 257.44 g/mol |
| Exact Mass | 255.92 |
| IUPAC Name | (1R)-2,2,2-trichloro-1-dimethoxyphosphorylethanol |
| SMILES | COP(=O)(OC)[C@@H](O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H8Cl3O4P/c1-10-12(9,11-2)3(8)4(5,6)7/h3,8H,1-2H3/t3-/m1/s1 |
| InChIKey | NFACJZMKEDPNKN-GSVOUGTGSA-N |
| XLogP | 2.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1R)-2,2,2-trichloro-1-dimethoxyphosphorylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2,2,2-trichloro-1-dimethoxyphosphorylethanol?
The IUPAC name of (1R)-2,2,2-trichloro-1-dimethoxyphosphorylethanol (CID 6604183) is (1R)-2,2,2-trichloro-1-dimethoxyphosphorylethanol.
What is the SMILES notation for (1R)-2,2,2-trichloro-1-dimethoxyphosphorylethanol?
The canonical SMILES for (1R)-2,2,2-trichloro-1-dimethoxyphosphorylethanol is COP(=O)(OC)[C@@H](O)C(Cl)(Cl)Cl.
What is the InChIKey of (1R)-2,2,2-trichloro-1-dimethoxyphosphorylethanol?
The InChIKey is NFACJZMKEDPNKN-GSVOUGTGSA-N. The full InChI is InChI=1S/C4H8Cl3O4P/c1-10-12(9,11-2)3(8)4(5,6)7/h3,8H,1-2H3/t3-/m1/s1.
What are the key properties of (1R)-2,2,2-trichloro-1-dimethoxyphosphorylethanol?
(1R)-2,2,2-trichloro-1-dimethoxyphosphorylethanol has a molecular weight of 257.44 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2,2,2-trichloro-1-dimethoxyphosphorylethanol is sourced from PubChem (CID 6604183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).