C16H14BrClF2 — CID 66042525
1-[2-(bromomethyl)-3-(3-chlorophenyl)propyl]-2,3-difluorobenzene (PubChem CID 66042525) has the molecular formula C16H14BrClF2 and a molecular weight of 359.64 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-3-(3-chlorophenyl)propyl]-2,3-difluorobenzene.
| Compound Name | 1-[2-(bromomethyl)-3-(3-chlorophenyl)propyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 66042525 |
| Molecular Formula | C16H14BrClF2 |
| Molecular Weight | 359.64 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | 1-[2-(bromomethyl)-3-(3-chlorophenyl)propyl]-2,3-difluorobenzene |
| SMILES | Fc1cccc(CC(CBr)Cc2cccc(Cl)c2)c1F |
| InChI | InChI=1S/C16H14BrClF2/c17-10-12(7-11-3-1-5-14(18)9-11)8-13-4-2-6-15(19)16(13)20/h1-6,9,12H,7-8,10H2 |
| InChIKey | ZHCMCYWPKKHKHP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.64 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|