C20H13N7S2 — CID 660426
2-[(10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methylsulfanyl]-1,3-benzothiazole (PubChem CID 660426) has the molecular formula C20H13N7S2 and a molecular weight of 415.51 g/mol. Its IUPAC name is 2-[(10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methylsulfanyl]-1,3-benzothiazole.
| Compound Name | 2-[(10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methylsulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 660426 |
| Molecular Formula | C20H13N7S2 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 2-[(10-phenyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methylsulfanyl]-1,3-benzothiazole |
| SMILES | c1ccc(-n2ncc3c2ncn2nc(CSc4nc5ccccc5s4)nc32)cc1 |
| InChI | InChI=1S/C20H13N7S2/c1-2-6-13(7-3-1)27-18-14(10-22-27)19-24-17(25-26(19)12-21-18)11-28-20-23-15-8-4-5-9-16(15)29-20/h1-10,12H,11H2 |
| InChIKey | HKEDVODTIQPIFI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 73.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |