C20H34O5 — CID 6604280
7-[(1R,2S,3R)-3-hydroxy-2-[(Z,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoic acid (PubChem CID 6604280) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is 7-[(1R,2S,3R)-3-hydroxy-2-[(Z,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2S,3R)-3-hydroxy-2-[(Z,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 6604280 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 7-[(1R,2S,3R)-3-hydroxy-2-[(Z,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoic acid |
| SMILES | CCCCC[C@H](O)/C=C\[C@@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,15-17,19,21,23H,2-11,14H2,1H3,(H,24,25)/b13-12-/t15-,16+,17-,19+/m0/s1 |
| InChIKey | GMVPRGQOIOIIMI-UIODNQDVSA-N |
| XLogP | 3.48 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|