About 4-[ethyl-[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino]butyl 3,4-dimethoxybenzoate
4-[ethyl-[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino]butyl 3,4-dimethoxybenzoate (PubChem CID 6604311) has the molecular formula C25H35NO5
and a molecular weight of 429.56 g/mol. Its IUPAC name is 4-[ethyl-[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino]butyl 3,4-dimethoxybenzoate.
Molecular Properties
| Compound Name | 4-[ethyl-[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino]butyl 3,4-dimethoxybenzoate |
| PubChem CID | 6604311 |
| Molecular Formula | C25H35NO5 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 4-[ethyl-[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino]butyl 3,4-dimethoxybenzoate |
| SMILES | CCN(CCCCOC(=O)c1ccc(OC)c(OC)c1)[C@@H](C)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H35NO5/c1-6-26(19(2)17-20-9-12-22(28-3)13-10-20)15-7-8-16-31-25(27)21-11-14-23(29-4)24(18-21)30-5/h9-14,18-19H,6-8,15-17H2,1-5H3/t19-/m0/s1 |
| InChIKey | VYVKHNNGDFVQGA-IBGZPJMESA-N |
| XLogP | 4.60 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[ethyl-[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino]butyl 3,4-dimethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[ethyl-[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino]butyl 3,4-dimethoxybenzoate?
The IUPAC name of 4-[ethyl-[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino]butyl 3,4-dimethoxybenzoate (CID 6604311) is 4-[ethyl-[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino]butyl 3,4-dimethoxybenzoate.
What is the SMILES notation for 4-[ethyl-[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino]butyl 3,4-dimethoxybenzoate?
The canonical SMILES for 4-[ethyl-[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino]butyl 3,4-dimethoxybenzoate is CCN(CCCCOC(=O)c1ccc(OC)c(OC)c1)[C@@H](C)Cc1ccc(OC)cc1.
What is the InChIKey of 4-[ethyl-[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino]butyl 3,4-dimethoxybenzoate?
The InChIKey is VYVKHNNGDFVQGA-IBGZPJMESA-N. The full InChI is InChI=1S/C25H35NO5/c1-6-26(19(2)17-20-9-12-22(28-3)13-10-20)15-7-8-16-31-25(27)21-11-14-23(29-4)24(18-21)30-5/h9-14,18-19H,6-8,15-17H2,1-5H3/t19-/m0/s1.
What are the key properties of 4-[ethyl-[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino]butyl 3,4-dimethoxybenzoate?
4-[ethyl-[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino]butyl 3,4-dimethoxybenzoate has a molecular weight of 429.56 g/mol, XLogP of 4.60, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[ethyl-[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino]butyl 3,4-dimethoxybenzoate is sourced from PubChem (CID 6604311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).