C10H16O3 — CID 66043840
1-(1,4-dioxan-2-yl)-3-methylidenepentan-1-one (PubChem CID 66043840) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-yl)-3-methylidenepentan-1-one.
| Compound Name | 1-(1,4-dioxan-2-yl)-3-methylidenepentan-1-one |
|---|---|
| PubChem CID | 66043840 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 1-(1,4-dioxan-2-yl)-3-methylidenepentan-1-one |
| SMILES | C=C(CC)CC(=O)C1COCCO1 |
| InChI | InChI=1S/C10H16O3/c1-3-8(2)6-9(11)10-7-12-4-5-13-10/h10H,2-7H2,1H3 |
| InChIKey | LFLQNRRHHLZRLW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|