About Prestwick-14A03
Prestwick-14A03 (PubChem CID 6604470) has the molecular formula C21H36NO+
and a molecular weight of 318.50 g/mol. Its IUPAC name is [(3R)-3-cyclohexyl-3-hydroxy-3-phenylpropyl]-triethylazanium.
Molecular Properties
| Compound Name | Prestwick-14A03 |
| PubChem CID | 6604470 |
| Molecular Formula | C21H36NO+ |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.28 |
| IUPAC Name | [(3R)-3-cyclohexyl-3-hydroxy-3-phenylpropyl]-triethylazanium |
| SMILES | CC[N+](CC)(CC)CC[C@@](C1CCCCC1)(C2=CC=CC=C2)O |
| InChI | InChI=1S/C21H36NO/c1-4-22(5-2,6-3)18-17-21(23,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7,9-10,13-14,20,23H,4-6,8,11-12,15-18H2,1-3H3/q+1/t21-/m0/s1 |
| InChIKey | NPRHVSBSZMAEIN-NRFANRHFSA-N |
| XLogP | 4.80 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | 318 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze Prestwick-14A03 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Prestwick-14A03?
The IUPAC name of Prestwick-14A03 (CID 6604470) is [(3R)-3-cyclohexyl-3-hydroxy-3-phenylpropyl]-triethylazanium.
What is the SMILES notation for Prestwick-14A03?
The canonical SMILES for Prestwick-14A03 is CC[N+](CC)(CC)CC[C@@](C1CCCCC1)(C2=CC=CC=C2)O.
What is the InChIKey of Prestwick-14A03?
The InChIKey is NPRHVSBSZMAEIN-NRFANRHFSA-N. The full InChI is InChI=1S/C21H36NO/c1-4-22(5-2,6-3)18-17-21(23,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7,9-10,13-14,20,23H,4-6,8,11-12,15-18H2,1-3H3/q+1/t21-/m0/s1.
What are the key properties of Prestwick-14A03?
Prestwick-14A03 has a molecular weight of 318.50 g/mol, XLogP of 4.80, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Prestwick-14A03 is sourced from PubChem (CID 6604470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).