About 3,3-diphenyl-N-[(2S)-1-phenylpropan-2-yl]propan-1-amine;(2S)-2-hydroxypropanoic acid
3,3-diphenyl-N-[(2S)-1-phenylpropan-2-yl]propan-1-amine;(2S)-2-hydroxypropanoic acid (PubChem CID 6604472) has the molecular formula C27H33NO3
and a molecular weight of 419.57 g/mol. Its IUPAC name is 3,3-diphenyl-N-[(2S)-1-phenylpropan-2-yl]propan-1-amine;(2S)-2-hydroxypropanoic acid.
Molecular Properties
| Compound Name | 3,3-diphenyl-N-[(2S)-1-phenylpropan-2-yl]propan-1-amine;(2S)-2-hydroxypropanoic acid |
| PubChem CID | 6604472 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 3,3-diphenyl-N-[(2S)-1-phenylpropan-2-yl]propan-1-amine;(2S)-2-hydroxypropanoic acid |
| SMILES | C[C@@H](Cc1ccccc1)NCCC(c1ccccc1)c1ccccc1.C[C@H](O)C(=O)O |
| InChI | InChI=1S/C24H27N.C3H6O3/c1-20(19-21-11-5-2-6-12-21)25-18-17-24(22-13-7-3-8-14-22)23-15-9-4-10-16-23;1-2(4)3(5)6/h2-16,20,24-25H,17-19H2,1H3;2,4H,1H3,(H,5,6)/t20-;2-/m00/s1 |
| InChIKey | QPOFIDVRLWJICD-XDELLUAHSA-N |
| XLogP | 4.88 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-diphenyl-N-[(2S)-1-phenylpropan-2-yl]propan-1-amine;(2S)-2-hydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diphenyl-N-[(2S)-1-phenylpropan-2-yl]propan-1-amine;(2S)-2-hydroxypropanoic acid?
The IUPAC name of 3,3-diphenyl-N-[(2S)-1-phenylpropan-2-yl]propan-1-amine;(2S)-2-hydroxypropanoic acid (CID 6604472) is 3,3-diphenyl-N-[(2S)-1-phenylpropan-2-yl]propan-1-amine;(2S)-2-hydroxypropanoic acid.
What is the SMILES notation for 3,3-diphenyl-N-[(2S)-1-phenylpropan-2-yl]propan-1-amine;(2S)-2-hydroxypropanoic acid?
The canonical SMILES for 3,3-diphenyl-N-[(2S)-1-phenylpropan-2-yl]propan-1-amine;(2S)-2-hydroxypropanoic acid is C[C@@H](Cc1ccccc1)NCCC(c1ccccc1)c1ccccc1.C[C@H](O)C(=O)O.
What is the InChIKey of 3,3-diphenyl-N-[(2S)-1-phenylpropan-2-yl]propan-1-amine;(2S)-2-hydroxypropanoic acid?
The InChIKey is QPOFIDVRLWJICD-XDELLUAHSA-N. The full InChI is InChI=1S/C24H27N.C3H6O3/c1-20(19-21-11-5-2-6-12-21)25-18-17-24(22-13-7-3-8-14-22)23-15-9-4-10-16-23;1-2(4)3(5)6/h2-16,20,24-25H,17-19H2,1H3;2,4H,1H3,(H,5,6)/t20-;2-/m00/s1.
What are the key properties of 3,3-diphenyl-N-[(2S)-1-phenylpropan-2-yl]propan-1-amine;(2S)-2-hydroxypropanoic acid?
3,3-diphenyl-N-[(2S)-1-phenylpropan-2-yl]propan-1-amine;(2S)-2-hydroxypropanoic acid has a molecular weight of 419.57 g/mol, XLogP of 4.88, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diphenyl-N-[(2S)-1-phenylpropan-2-yl]propan-1-amine;(2S)-2-hydroxypropanoic acid is sourced from PubChem (CID 6604472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).