C16H18F3N3O4S — CID 660458
methyl 2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-3,3,3-trifluoro-2-(propanoylamino)propanoate (PubChem CID 660458) has the molecular formula C16H18F3N3O4S and a molecular weight of 405.40 g/mol. Its IUPAC name is methyl 2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-3,3,3-trifluoro-2-(propanoylamino)propanoate.
| Compound Name | methyl 2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-3,3,3-trifluoro-2-(propanoylamino)propanoate |
|---|---|
| PubChem CID | 660458 |
| Molecular Formula | C16H18F3N3O4S |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | methyl 2-[(6-ethoxy-1,3-benzothiazol-2-yl)amino]-3,3,3-trifluoro-2-(propanoylamino)propanoate |
| SMILES | CCOc1ccc2nc(NC(NC(=O)CC)(C(=O)OC)C(F)(F)F)sc2c1 |
| InChI | InChI=1S/C16H18F3N3O4S/c1-4-12(23)21-15(13(24)25-3,16(17,18)19)22-14-20-10-7-6-9(26-5-2)8-11(10)27-14/h6-8H,4-5H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | IAPUWMMVMPOVSB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|