About N-(2-methylidenebutyl)-1,1-dioxothiolan-3-amine
N-(2-methylidenebutyl)-1,1-dioxothiolan-3-amine (PubChem CID 66047100) has the molecular formula C9H17NO2S
and a molecular weight of 203.31 g/mol. Its IUPAC name is N-(2-methylidenebutyl)-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | N-(2-methylidenebutyl)-1,1-dioxothiolan-3-amine |
| PubChem CID | 66047100 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | N-(2-methylidenebutyl)-1,1-dioxothiolan-3-amine |
| SMILES | C=C(CC)CNC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H17NO2S/c1-3-8(2)6-10-9-4-5-13(11,12)7-9/h9-10H,2-7H2,1H3 |
| InChIKey | BSFVXMIPGJSCLH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methylidenebutyl)-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylidenebutyl)-1,1-dioxothiolan-3-amine?
The IUPAC name of N-(2-methylidenebutyl)-1,1-dioxothiolan-3-amine (CID 66047100) is N-(2-methylidenebutyl)-1,1-dioxothiolan-3-amine.
What is the SMILES notation for N-(2-methylidenebutyl)-1,1-dioxothiolan-3-amine?
The canonical SMILES for N-(2-methylidenebutyl)-1,1-dioxothiolan-3-amine is C=C(CC)CNC1CCS(=O)(=O)C1.
What is the InChIKey of N-(2-methylidenebutyl)-1,1-dioxothiolan-3-amine?
The InChIKey is BSFVXMIPGJSCLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2S/c1-3-8(2)6-10-9-4-5-13(11,12)7-9/h9-10H,2-7H2,1H3.
What are the key properties of N-(2-methylidenebutyl)-1,1-dioxothiolan-3-amine?
N-(2-methylidenebutyl)-1,1-dioxothiolan-3-amine has a molecular weight of 203.31 g/mol, XLogP of 0.73, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylidenebutyl)-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 66047100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).