C20H39NO3 — CID 6604750
N-[(Z,2S,3R)-1,3-dihydroxyoctadec-4-en-2-yl]acetamide (PubChem CID 6604750) has the molecular formula C20H39NO3 and a molecular weight of 341.54 g/mol. Its IUPAC name is N-[(Z,2S,3R)-1,3-dihydroxyoctadec-4-en-2-yl]acetamide.
| Compound Name | N-[(Z,2S,3R)-1,3-dihydroxyoctadec-4-en-2-yl]acetamide |
|---|---|
| PubChem CID | 6604750 |
| Molecular Formula | C20H39NO3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.29 |
| IUPAC Name | N-[(Z,2S,3R)-1,3-dihydroxyoctadec-4-en-2-yl]acetamide |
| SMILES | CCCCCCCCCCCCC/C=C\[C@@H](O)[C@H](CO)NC(C)=O |
| InChI | InChI=1S/C20H39NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(24)19(17-22)21-18(2)23/h15-16,19-20,22,24H,3-14,17H2,1-2H3,(H,21,23)/b16-15-/t19-,20+/m0/s1 |
| InChIKey | BLTCBVOJNNKFKC-JYFPHDFCSA-N |
| XLogP | 4.10 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|