C10H16BrF3O3S — CID 66048204
3-[1-bromo-4-(2,2,2-trifluoroethoxy)butan-2-yl]thiolane 1,1-dioxide (PubChem CID 66048204) has the molecular formula C10H16BrF3O3S and a molecular weight of 353.20 g/mol. Its IUPAC name is 3-[1-bromo-4-(2,2,2-trifluoroethoxy)butan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-bromo-4-(2,2,2-trifluoroethoxy)butan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 66048204 |
| Molecular Formula | C10H16BrF3O3S |
| Molecular Weight | 353.20 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 3-[1-bromo-4-(2,2,2-trifluoroethoxy)butan-2-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C(CBr)CCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C10H16BrF3O3S/c11-5-8(1-3-17-7-10(12,13)14)9-2-4-18(15,16)6-9/h8-9H,1-7H2 |
| InChIKey | VJJCCXPTDSZCFA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.20 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|