About 4-(3-chlorophenyl)-1,7-diethylpyrido[2,3-d]pyrimidin-2-one
4-(3-chlorophenyl)-1,7-diethylpyrido[2,3-d]pyrimidin-2-one (PubChem CID 6604918) has the molecular formula C17H16ClN3O
and a molecular weight of 313.79 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-1,7-diethylpyrido[2,3-d]pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-(3-chlorophenyl)-1,7-diethylpyrido[2,3-d]pyrimidin-2-one |
| PubChem CID | 6604918 |
| Molecular Formula | C17H16ClN3O |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 4-(3-chlorophenyl)-1,7-diethylpyrido[2,3-d]pyrimidin-2-one |
| SMILES | CCc1ccc2c(-c3cccc(Cl)c3)nc(=O)n(CC)c2n1 |
| InChI | InChI=1S/C17H16ClN3O/c1-3-13-8-9-14-15(11-6-5-7-12(18)10-11)20-17(22)21(4-2)16(14)19-13/h5-10H,3-4H2,1-2H3 |
| InChIKey | MNHXYNNKDDXKNP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3-chlorophenyl)-1,7-diethylpyrido[2,3-d]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chlorophenyl)-1,7-diethylpyrido[2,3-d]pyrimidin-2-one?
The IUPAC name of 4-(3-chlorophenyl)-1,7-diethylpyrido[2,3-d]pyrimidin-2-one (CID 6604918) is 4-(3-chlorophenyl)-1,7-diethylpyrido[2,3-d]pyrimidin-2-one.
What is the SMILES notation for 4-(3-chlorophenyl)-1,7-diethylpyrido[2,3-d]pyrimidin-2-one?
The canonical SMILES for 4-(3-chlorophenyl)-1,7-diethylpyrido[2,3-d]pyrimidin-2-one is CCc1ccc2c(-c3cccc(Cl)c3)nc(=O)n(CC)c2n1.
What is the InChIKey of 4-(3-chlorophenyl)-1,7-diethylpyrido[2,3-d]pyrimidin-2-one?
The InChIKey is MNHXYNNKDDXKNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClN3O/c1-3-13-8-9-14-15(11-6-5-7-12(18)10-11)20-17(22)21(4-2)16(14)19-13/h5-10H,3-4H2,1-2H3.
What are the key properties of 4-(3-chlorophenyl)-1,7-diethylpyrido[2,3-d]pyrimidin-2-one?
4-(3-chlorophenyl)-1,7-diethylpyrido[2,3-d]pyrimidin-2-one has a molecular weight of 313.79 g/mol, XLogP of 3.69, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chlorophenyl)-1,7-diethylpyrido[2,3-d]pyrimidin-2-one is sourced from PubChem (CID 6604918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).