About 5-(1-adamantylmethylamino)pentyl-trimethylazanium;bromide;hydrobromide
5-(1-adamantylmethylamino)pentyl-trimethylazanium;bromide;hydrobromide (PubChem CID 6604954) has the molecular formula C19H38Br2N2
and a molecular weight of 454.34 g/mol. Its IUPAC name is 5-(1-adamantylmethylamino)pentyl-trimethylazanium;bromide;hydrobromide.
Molecular Properties
| Compound Name | 5-(1-adamantylmethylamino)pentyl-trimethylazanium;bromide;hydrobromide |
| PubChem CID | 6604954 |
| Molecular Formula | C19H38Br2N2 |
| Molecular Weight | 454.34 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 5-(1-adamantylmethylamino)pentyl-trimethylazanium;bromide;hydrobromide |
| SMILES | Br.C[N+](C)(C)CCCCCNCC12CC3CC(CC(C3)C1)C2.[Br-] |
| InChI | InChI=1S/C19H37N2.2BrH/c1-21(2,3)8-6-4-5-7-20-15-19-12-16-9-17(13-19)11-18(10-16)14-19;;/h16-18,20H,4-15H2,1-3H3;2*1H/q+1;;/p-1 |
| InChIKey | CQTDZUSQSTUZDA-UHFFFAOYSA-M |
| XLogP | 1.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-adamantylmethylamino)pentyl-trimethylazanium;bromide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-adamantylmethylamino)pentyl-trimethylazanium;bromide;hydrobromide?
The IUPAC name of 5-(1-adamantylmethylamino)pentyl-trimethylazanium;bromide;hydrobromide (CID 6604954) is 5-(1-adamantylmethylamino)pentyl-trimethylazanium;bromide;hydrobromide.
What is the SMILES notation for 5-(1-adamantylmethylamino)pentyl-trimethylazanium;bromide;hydrobromide?
The canonical SMILES for 5-(1-adamantylmethylamino)pentyl-trimethylazanium;bromide;hydrobromide is Br.C[N+](C)(C)CCCCCNCC12CC3CC(CC(C3)C1)C2.[Br-].
What is the InChIKey of 5-(1-adamantylmethylamino)pentyl-trimethylazanium;bromide;hydrobromide?
The InChIKey is CQTDZUSQSTUZDA-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H37N2.2BrH/c1-21(2,3)8-6-4-5-7-20-15-19-12-16-9-17(13-19)11-18(10-16)14-19;;/h16-18,20H,4-15H2,1-3H3;2*1H/q+1;;/p-1.
What are the key properties of 5-(1-adamantylmethylamino)pentyl-trimethylazanium;bromide;hydrobromide?
5-(1-adamantylmethylamino)pentyl-trimethylazanium;bromide;hydrobromide has a molecular weight of 454.34 g/mol, XLogP of 1.25, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-adamantylmethylamino)pentyl-trimethylazanium;bromide;hydrobromide is sourced from PubChem (CID 6604954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).