C11H18BrF3O3S — CID 66049944
3-[1-bromo-5-(2,2,2-trifluoroethoxy)pentan-2-yl]thiolane 1,1-dioxide (PubChem CID 66049944) has the molecular formula C11H18BrF3O3S and a molecular weight of 367.23 g/mol. Its IUPAC name is 3-[1-bromo-5-(2,2,2-trifluoroethoxy)pentan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-bromo-5-(2,2,2-trifluoroethoxy)pentan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 66049944 |
| Molecular Formula | C11H18BrF3O3S |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 3-[1-bromo-5-(2,2,2-trifluoroethoxy)pentan-2-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C(CBr)CCCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C11H18BrF3O3S/c12-6-9(10-3-5-19(16,17)7-10)2-1-4-18-8-11(13,14)15/h9-10H,1-8H2 |
| InChIKey | URWYQRQEQVMSGV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|