About 5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-1,3-diethylpyrazole
5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-1,3-diethylpyrazole (PubChem CID 66050345) has the molecular formula C17H22Cl2N2
and a molecular weight of 325.28 g/mol. Its IUPAC name is 5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-1,3-diethylpyrazole.
Molecular Properties
| Compound Name | 5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-1,3-diethylpyrazole |
| PubChem CID | 66050345 |
| Molecular Formula | C17H22Cl2N2 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-1,3-diethylpyrazole |
| SMILES | CCc1cc(CC(CCl)Cc2ccccc2Cl)n(CC)n1 |
| InChI | InChI=1S/C17H22Cl2N2/c1-3-15-11-16(21(4-2)20-15)10-13(12-18)9-14-7-5-6-8-17(14)19/h5-8,11,13H,3-4,9-10,12H2,1-2H3 |
| InChIKey | LUZZXXALKAGFPQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-1,3-diethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-1,3-diethylpyrazole?
The IUPAC name of 5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-1,3-diethylpyrazole (CID 66050345) is 5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-1,3-diethylpyrazole.
What is the SMILES notation for 5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-1,3-diethylpyrazole?
The canonical SMILES for 5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-1,3-diethylpyrazole is CCc1cc(CC(CCl)Cc2ccccc2Cl)n(CC)n1.
What is the InChIKey of 5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-1,3-diethylpyrazole?
The InChIKey is LUZZXXALKAGFPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22Cl2N2/c1-3-15-11-16(21(4-2)20-15)10-13(12-18)9-14-7-5-6-8-17(14)19/h5-8,11,13H,3-4,9-10,12H2,1-2H3.
What are the key properties of 5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-1,3-diethylpyrazole?
5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-1,3-diethylpyrazole has a molecular weight of 325.28 g/mol, XLogP of 4.76, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(chloromethyl)-3-(2-chlorophenyl)propyl]-1,3-diethylpyrazole is sourced from PubChem (CID 66050345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).