About 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol
1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol (PubChem CID 66051281) has the molecular formula C15H21ClN4O
and a molecular weight of 308.81 g/mol. Its IUPAC name is 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol.
Molecular Properties
| Compound Name | 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol |
| PubChem CID | 66051281 |
| Molecular Formula | C15H21ClN4O |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol |
| SMILES | CN(C)CC1CC(O)CN1Cc1cn2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C15H21ClN4O/c1-18(2)9-13-5-14(21)10-19(13)7-12-8-20-6-11(16)3-4-15(20)17-12/h3-4,6,8,13-14,21H,5,7,9-10H2,1-2H3 |
| InChIKey | NXTQMSUDPPXBHO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 44.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol?
The IUPAC name of 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol (CID 66051281) is 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol.
What is the SMILES notation for 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol?
The canonical SMILES for 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol is CN(C)CC1CC(O)CN1Cc1cn2cc(Cl)ccc2n1.
What is the InChIKey of 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol?
The InChIKey is NXTQMSUDPPXBHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21ClN4O/c1-18(2)9-13-5-14(21)10-19(13)7-12-8-20-6-11(16)3-4-15(20)17-12/h3-4,6,8,13-14,21H,5,7,9-10H2,1-2H3.
What are the key properties of 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol?
1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol has a molecular weight of 308.81 g/mol, XLogP of 1.48, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol is sourced from PubChem (CID 66051281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).