C21H36N2O3 — CID 660515
3,7-di(hexanoyl)-1,5-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-one (PubChem CID 660515) has the molecular formula C21H36N2O3 and a molecular weight of 364.53 g/mol. Its IUPAC name is 3,7-di(hexanoyl)-1,5-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-one.
| Compound Name | 3,7-di(hexanoyl)-1,5-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-one |
|---|---|
| PubChem CID | 660515 |
| Molecular Formula | C21H36N2O3 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.27 |
| IUPAC Name | 3,7-di(hexanoyl)-1,5-dimethyl-3,7-diazabicyclo[3.3.1]nonan-9-one |
| SMILES | CCCCCC(=O)N1CC2(C)CN(C(=O)CCCCC)CC(C)(C1)C2=O |
| InChI | InChI=1S/C21H36N2O3/c1-5-7-9-11-17(24)22-13-20(3)15-23(18(25)12-10-8-6-2)16-21(4,14-22)19(20)26/h5-16H2,1-4H3 |
| InChIKey | OOTYCKUCDSBCGL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|