About 2-methyl-9-[(1-methylpiperidin-4-yl)methyl]-N,8-diphenylpurin-6-amine
2-methyl-9-[(1-methylpiperidin-4-yl)methyl]-N,8-diphenylpurin-6-amine (PubChem CID 6605218) has the molecular formula C25H28N6
and a molecular weight of 412.54 g/mol. Its IUPAC name is 2-methyl-9-[(1-methylpiperidin-4-yl)methyl]-N,8-diphenylpurin-6-amine.
Molecular Properties
| Compound Name | 2-methyl-9-[(1-methylpiperidin-4-yl)methyl]-N,8-diphenylpurin-6-amine |
| PubChem CID | 6605218 |
| Molecular Formula | C25H28N6 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 2-methyl-9-[(1-methylpiperidin-4-yl)methyl]-N,8-diphenylpurin-6-amine |
| SMILES | Cc1nc(Nc2ccccc2)c2nc(-c3ccccc3)n(CC3CCN(C)CC3)c2n1 |
| InChI | InChI=1S/C25H28N6/c1-18-26-23(28-21-11-7-4-8-12-21)22-25(27-18)31(17-19-13-15-30(2)16-14-19)24(29-22)20-9-5-3-6-10-20/h3-12,19H,13-17H2,1-2H3,(H,26,27,28) |
| InChIKey | BBEPSSMYQDRPJW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methyl-9-[(1-methylpiperidin-4-yl)methyl]-N,8-diphenylpurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-9-[(1-methylpiperidin-4-yl)methyl]-N,8-diphenylpurin-6-amine?
The IUPAC name of 2-methyl-9-[(1-methylpiperidin-4-yl)methyl]-N,8-diphenylpurin-6-amine (CID 6605218) is 2-methyl-9-[(1-methylpiperidin-4-yl)methyl]-N,8-diphenylpurin-6-amine.
What is the SMILES notation for 2-methyl-9-[(1-methylpiperidin-4-yl)methyl]-N,8-diphenylpurin-6-amine?
The canonical SMILES for 2-methyl-9-[(1-methylpiperidin-4-yl)methyl]-N,8-diphenylpurin-6-amine is Cc1nc(Nc2ccccc2)c2nc(-c3ccccc3)n(CC3CCN(C)CC3)c2n1.
What is the InChIKey of 2-methyl-9-[(1-methylpiperidin-4-yl)methyl]-N,8-diphenylpurin-6-amine?
The InChIKey is BBEPSSMYQDRPJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28N6/c1-18-26-23(28-21-11-7-4-8-12-21)22-25(27-18)31(17-19-13-15-30(2)16-14-19)24(29-22)20-9-5-3-6-10-20/h3-12,19H,13-17H2,1-2H3,(H,26,27,28).
What are the key properties of 2-methyl-9-[(1-methylpiperidin-4-yl)methyl]-N,8-diphenylpurin-6-amine?
2-methyl-9-[(1-methylpiperidin-4-yl)methyl]-N,8-diphenylpurin-6-amine has a molecular weight of 412.54 g/mol, XLogP of 4.89, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-9-[(1-methylpiperidin-4-yl)methyl]-N,8-diphenylpurin-6-amine is sourced from PubChem (CID 6605218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).