C8H18N4O2 — CID 66052226
2-[(dimethylamino)methyl]-N',4-dihydroxypyrrolidine-1-carboximidamide (PubChem CID 66052226) has the molecular formula C8H18N4O2 and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-N',4-dihydroxypyrrolidine-1-carboximidamide.
| Compound Name | 2-[(dimethylamino)methyl]-N',4-dihydroxypyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 66052226 |
| Molecular Formula | C8H18N4O2 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 2-[(dimethylamino)methyl]-N',4-dihydroxypyrrolidine-1-carboximidamide |
| SMILES | CN(C)CC1CC(O)CN1/C(N)=N/O |
| InChI | InChI=1S/C8H18N4O2/c1-11(2)4-6-3-7(13)5-12(6)8(9)10-14/h6-7,13-14H,3-5H2,1-2H3,(H2,9,10) |
| InChIKey | ASPRENOVAUERFB-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|