C15H23ClN2O2 — CID 66052241
1-[2-(3-chlorophenoxy)ethyl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol (PubChem CID 66052241) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is 1-[2-(3-chlorophenoxy)ethyl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol.
| Compound Name | 1-[2-(3-chlorophenoxy)ethyl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 66052241 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1-[2-(3-chlorophenoxy)ethyl]-5-[(dimethylamino)methyl]pyrrolidin-3-ol |
| SMILES | CN(C)CC1CC(O)CN1CCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H23ClN2O2/c1-17(2)10-13-9-14(19)11-18(13)6-7-20-15-5-3-4-12(16)8-15/h3-5,8,13-14,19H,6-7,9-11H2,1-2H3 |
| InChIKey | PWUZIAYDKSQBKH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |