C14H27N3O4 — CID 66052543
2-[[2-[(dimethylamino)methyl]-4-hydroxypyrrolidine-1-carbonyl]amino]hexanoic acid (PubChem CID 66052543) has the molecular formula C14H27N3O4 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[[2-[(dimethylamino)methyl]-4-hydroxypyrrolidine-1-carbonyl]amino]hexanoic acid.
| Compound Name | 2-[[2-[(dimethylamino)methyl]-4-hydroxypyrrolidine-1-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 66052543 |
| Molecular Formula | C14H27N3O4 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 2-[[2-[(dimethylamino)methyl]-4-hydroxypyrrolidine-1-carbonyl]amino]hexanoic acid |
| SMILES | CCCCC(NC(=O)N1CC(O)CC1CN(C)C)C(=O)O |
| InChI | InChI=1S/C14H27N3O4/c1-4-5-6-12(13(19)20)15-14(21)17-9-11(18)7-10(17)8-16(2)3/h10-12,18H,4-9H2,1-3H3,(H,15,21)(H,19,20) |
| InChIKey | BKLIOQIOSZXVMW-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |