C12H13FN2OS — CID 66052682
2-(2-fluorophenyl)sulfanyl-1-(2-methylpyrazol-3-yl)ethanol (PubChem CID 66052682) has the molecular formula C12H13FN2OS and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-(2-fluorophenyl)sulfanyl-1-(2-methylpyrazol-3-yl)ethanol.
| Compound Name | 2-(2-fluorophenyl)sulfanyl-1-(2-methylpyrazol-3-yl)ethanol |
|---|---|
| PubChem CID | 66052682 |
| Molecular Formula | C12H13FN2OS |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2-(2-fluorophenyl)sulfanyl-1-(2-methylpyrazol-3-yl)ethanol |
| SMILES | Cn1nccc1C(O)CSc1ccccc1F |
| InChI | InChI=1S/C12H13FN2OS/c1-15-10(6-7-14-15)11(16)8-17-12-5-3-2-4-9(12)13/h2-7,11,16H,8H2,1H3 |
| InChIKey | HONRGHIGLNGKDB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |