C15H21FN2O3 — CID 66053338
[2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]-(3-fluoro-4-methoxyphenyl)methanone (PubChem CID 66053338) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is [2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]-(3-fluoro-4-methoxyphenyl)methanone.
| Compound Name | [2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]-(3-fluoro-4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 66053338 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | [2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]-(3-fluoro-4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CC(O)CC2CN(C)C)cc1F |
| InChI | InChI=1S/C15H21FN2O3/c1-17(2)8-11-7-12(19)9-18(11)15(20)10-4-5-14(21-3)13(16)6-10/h4-6,11-12,19H,7-9H2,1-3H3 |
| InChIKey | HJNVFKSDLRYIJY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |