C13H19ClN2O3S — CID 66053365
1-(4-chlorophenyl)sulfonyl-5-[(dimethylamino)methyl]pyrrolidin-3-ol (PubChem CID 66053365) has the molecular formula C13H19ClN2O3S and a molecular weight of 318.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-5-[(dimethylamino)methyl]pyrrolidin-3-ol.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-5-[(dimethylamino)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 66053365 |
| Molecular Formula | C13H19ClN2O3S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-5-[(dimethylamino)methyl]pyrrolidin-3-ol |
| SMILES | CN(C)CC1CC(O)CN1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H19ClN2O3S/c1-15(2)8-11-7-12(17)9-16(11)20(18,19)13-5-3-10(14)4-6-13/h3-6,11-12,17H,7-9H2,1-2H3 |
| InChIKey | ZWKXGVKFPZUVON-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |