About diethyl 4-amino-1H-imidazole-2,5-dicarboxylate
diethyl 4-amino-1H-imidazole-2,5-dicarboxylate (PubChem CID 660541) has the molecular formula C9H13N3O4
and a molecular weight of 227.22 g/mol. Its IUPAC name is diethyl 4-amino-1H-imidazole-2,5-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 4-amino-1H-imidazole-2,5-dicarboxylate |
| PubChem CID | 660541 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | diethyl 4-amino-1H-imidazole-2,5-dicarboxylate |
| SMILES | CCOC(=O)c1nc(N)c(C(=O)OCC)[nH]1 |
| InChI | InChI=1S/C9H13N3O4/c1-3-15-8(13)5-6(10)12-7(11-5)9(14)16-4-2/h3-4,10H2,1-2H3,(H,11,12) |
| InChIKey | QWCGZDVIVAHGRP-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze diethyl 4-amino-1H-imidazole-2,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 4-amino-1H-imidazole-2,5-dicarboxylate?
The IUPAC name of diethyl 4-amino-1H-imidazole-2,5-dicarboxylate (CID 660541) is diethyl 4-amino-1H-imidazole-2,5-dicarboxylate.
What is the SMILES notation for diethyl 4-amino-1H-imidazole-2,5-dicarboxylate?
The canonical SMILES for diethyl 4-amino-1H-imidazole-2,5-dicarboxylate is CCOC(=O)c1nc(N)c(C(=O)OCC)[nH]1.
What is the InChIKey of diethyl 4-amino-1H-imidazole-2,5-dicarboxylate?
The InChIKey is QWCGZDVIVAHGRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O4/c1-3-15-8(13)5-6(10)12-7(11-5)9(14)16-4-2/h3-4,10H2,1-2H3,(H,11,12).
What are the key properties of diethyl 4-amino-1H-imidazole-2,5-dicarboxylate?
diethyl 4-amino-1H-imidazole-2,5-dicarboxylate has a molecular weight of 227.22 g/mol, XLogP of 0.35, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 4-amino-1H-imidazole-2,5-dicarboxylate is sourced from PubChem (CID 660541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).