C10H19BrN2O — CID 66054174
1-(2-bromoprop-2-enyl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol (PubChem CID 66054174) has the molecular formula C10H19BrN2O and a molecular weight of 263.18 g/mol. Its IUPAC name is 1-(2-bromoprop-2-enyl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol.
| Compound Name | 1-(2-bromoprop-2-enyl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 66054174 |
| Molecular Formula | C10H19BrN2O |
| Molecular Weight | 263.18 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 1-(2-bromoprop-2-enyl)-5-[(dimethylamino)methyl]pyrrolidin-3-ol |
| SMILES | C=C(Br)CN1CC(O)CC1CN(C)C |
| InChI | InChI=1S/C10H19BrN2O/c1-8(11)5-13-7-10(14)4-9(13)6-12(2)3/h9-10,14H,1,4-7H2,2-3H3 |
| InChIKey | WYOARYBRHJTVGR-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |