About 1-(4-bromophenyl)sulfanyl-5,5,5-trifluoropentan-2-ol
1-(4-bromophenyl)sulfanyl-5,5,5-trifluoropentan-2-ol (PubChem CID 66054491) has the molecular formula C11H12BrF3OS
and a molecular weight of 329.18 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfanyl-5,5,5-trifluoropentan-2-ol.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)sulfanyl-5,5,5-trifluoropentan-2-ol |
| PubChem CID | 66054491 |
| Molecular Formula | C11H12BrF3OS |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | 1-(4-bromophenyl)sulfanyl-5,5,5-trifluoropentan-2-ol |
| SMILES | OC(CCC(F)(F)F)CSc1ccc(Br)cc1 |
| InChI | InChI=1S/C11H12BrF3OS/c12-8-1-3-10(4-2-8)17-7-9(16)5-6-11(13,14)15/h1-4,9,16H,5-7H2 |
| InChIKey | QGHOQDLDZBCKTD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-bromophenyl)sulfanyl-5,5,5-trifluoropentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)sulfanyl-5,5,5-trifluoropentan-2-ol?
The IUPAC name of 1-(4-bromophenyl)sulfanyl-5,5,5-trifluoropentan-2-ol (CID 66054491) is 1-(4-bromophenyl)sulfanyl-5,5,5-trifluoropentan-2-ol.
What is the SMILES notation for 1-(4-bromophenyl)sulfanyl-5,5,5-trifluoropentan-2-ol?
The canonical SMILES for 1-(4-bromophenyl)sulfanyl-5,5,5-trifluoropentan-2-ol is OC(CCC(F)(F)F)CSc1ccc(Br)cc1.
What is the InChIKey of 1-(4-bromophenyl)sulfanyl-5,5,5-trifluoropentan-2-ol?
The InChIKey is QGHOQDLDZBCKTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrF3OS/c12-8-1-3-10(4-2-8)17-7-9(16)5-6-11(13,14)15/h1-4,9,16H,5-7H2.
What are the key properties of 1-(4-bromophenyl)sulfanyl-5,5,5-trifluoropentan-2-ol?
1-(4-bromophenyl)sulfanyl-5,5,5-trifluoropentan-2-ol has a molecular weight of 329.18 g/mol, XLogP of 4.24, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)sulfanyl-5,5,5-trifluoropentan-2-ol is sourced from PubChem (CID 66054491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).