C15H22FN3OS — CID 66054817
2-[[2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]methyl]-5-fluorobenzenecarbothioamide (PubChem CID 66054817) has the molecular formula C15H22FN3OS and a molecular weight of 311.43 g/mol. Its IUPAC name is 2-[[2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]methyl]-5-fluorobenzenecarbothioamide.
| Compound Name | 2-[[2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]methyl]-5-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 66054817 |
| Molecular Formula | C15H22FN3OS |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 2-[[2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]methyl]-5-fluorobenzenecarbothioamide |
| SMILES | CN(C)CC1CC(O)CN1Cc1ccc(F)cc1C(N)=S |
| InChI | InChI=1S/C15H22FN3OS/c1-18(2)8-12-6-13(20)9-19(12)7-10-3-4-11(16)5-14(10)15(17)21/h3-5,12-13,20H,6-9H2,1-2H3,(H2,17,21) |
| InChIKey | PNEMFTZDAMPMGB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|