C15H18FNO2S — CID 66055748
4-(dimethoxymethyl)-2-[2-(4-fluorophenyl)propan-2-yl]-1,3-thiazole (PubChem CID 66055748) has the molecular formula C15H18FNO2S and a molecular weight of 295.38 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-2-[2-(4-fluorophenyl)propan-2-yl]-1,3-thiazole.
| Compound Name | 4-(dimethoxymethyl)-2-[2-(4-fluorophenyl)propan-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 66055748 |
| Molecular Formula | C15H18FNO2S |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 4-(dimethoxymethyl)-2-[2-(4-fluorophenyl)propan-2-yl]-1,3-thiazole |
| SMILES | COC(OC)c1csc(C(C)(C)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H18FNO2S/c1-15(2,10-5-7-11(16)8-6-10)14-17-12(9-20-14)13(18-3)19-4/h5-9,13H,1-4H3 |
| InChIKey | RQVJTZJLQLKQQG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|