C12H19N5OS — CID 66056057
5-[2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]pyrazine-2-carbothioamide (PubChem CID 66056057) has the molecular formula C12H19N5OS and a molecular weight of 281.39 g/mol. Its IUPAC name is 5-[2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]pyrazine-2-carbothioamide.
| Compound Name | 5-[2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 66056057 |
| Molecular Formula | C12H19N5OS |
| Molecular Weight | 281.39 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 5-[2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]pyrazine-2-carbothioamide |
| SMILES | CN(C)CC1CC(O)CN1c1cnc(C(N)=S)cn1 |
| InChI | InChI=1S/C12H19N5OS/c1-16(2)6-8-3-9(18)7-17(8)11-5-14-10(4-15-11)12(13)19/h4-5,8-9,18H,3,6-7H2,1-2H3,(H2,13,19) |
| InChIKey | IHPNQWPLCJQRNM-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.39 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|