C8H10F3NO2S — CID 66056532
4-(dimethoxymethyl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole (PubChem CID 66056532) has the molecular formula C8H10F3NO2S and a molecular weight of 241.23 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole.
| Compound Name | 4-(dimethoxymethyl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 66056532 |
| Molecular Formula | C8H10F3NO2S |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 4-(dimethoxymethyl)-2-(2,2,2-trifluoroethyl)-1,3-thiazole |
| SMILES | COC(OC)c1csc(CC(F)(F)F)n1 |
| InChI | InChI=1S/C8H10F3NO2S/c1-13-7(14-2)5-4-15-6(12-5)3-8(9,10)11/h4,7H,3H2,1-2H3 |
| InChIKey | VZOIJTFRGDJNAT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|