C19H13N5O3 — CID 660582
2-(5-oxo-7-phenyl-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)isoindole-1,3-dione (PubChem CID 660582) has the molecular formula C19H13N5O3 and a molecular weight of 359.35 g/mol. Its IUPAC name is 2-(5-oxo-7-phenyl-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)isoindole-1,3-dione.
| Compound Name | 2-(5-oxo-7-phenyl-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 660582 |
| Molecular Formula | C19H13N5O3 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 2-(5-oxo-7-phenyl-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)isoindole-1,3-dione |
| SMILES | O=C1CC(c2ccccc2)n2nc(N3C(=O)c4ccccc4C3=O)nc2N1 |
| InChI | InChI=1S/C19H13N5O3/c25-15-10-14(11-6-2-1-3-7-11)24-18(20-15)21-19(22-24)23-16(26)12-8-4-5-9-13(12)17(23)27/h1-9,14H,10H2,(H,20,21,22,25) |
| InChIKey | JABAJTRJJGCPPH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|