C17H18F2O2 — CID 66058898
2-[(2,4-difluorophenyl)methyl]-3-(2-methoxyphenyl)propan-1-ol (PubChem CID 66058898) has the molecular formula C17H18F2O2 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-[(2,4-difluorophenyl)methyl]-3-(2-methoxyphenyl)propan-1-ol.
| Compound Name | 2-[(2,4-difluorophenyl)methyl]-3-(2-methoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 66058898 |
| Molecular Formula | C17H18F2O2 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-[(2,4-difluorophenyl)methyl]-3-(2-methoxyphenyl)propan-1-ol |
| SMILES | COc1ccccc1CC(CO)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C17H18F2O2/c1-21-17-5-3-2-4-14(17)9-12(11-20)8-13-6-7-15(18)10-16(13)19/h2-7,10,12,20H,8-9,11H2,1H3 |
| InChIKey | YDRSACHZNVHLNN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |