About [3-[3-(2,2,2-trifluoroethoxy)propyl]oxan-3-yl]methanol
[3-[3-(2,2,2-trifluoroethoxy)propyl]oxan-3-yl]methanol (PubChem CID 66059231) has the molecular formula C11H19F3O3
and a molecular weight of 256.26 g/mol. Its IUPAC name is [3-[3-(2,2,2-trifluoroethoxy)propyl]oxan-3-yl]methanol.
Molecular Properties
| Compound Name | [3-[3-(2,2,2-trifluoroethoxy)propyl]oxan-3-yl]methanol |
| PubChem CID | 66059231 |
| Molecular Formula | C11H19F3O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | [3-[3-(2,2,2-trifluoroethoxy)propyl]oxan-3-yl]methanol |
| SMILES | OCC1(CCCOCC(F)(F)F)CCCOC1 |
| InChI | InChI=1S/C11H19F3O3/c12-11(13,14)9-17-6-2-4-10(7-15)3-1-5-16-8-10/h15H,1-9H2 |
| InChIKey | SQLSCUHXQGJFPW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3-[3-(2,2,2-trifluoroethoxy)propyl]oxan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[3-(2,2,2-trifluoroethoxy)propyl]oxan-3-yl]methanol?
The IUPAC name of [3-[3-(2,2,2-trifluoroethoxy)propyl]oxan-3-yl]methanol (CID 66059231) is [3-[3-(2,2,2-trifluoroethoxy)propyl]oxan-3-yl]methanol.
What is the SMILES notation for [3-[3-(2,2,2-trifluoroethoxy)propyl]oxan-3-yl]methanol?
The canonical SMILES for [3-[3-(2,2,2-trifluoroethoxy)propyl]oxan-3-yl]methanol is OCC1(CCCOCC(F)(F)F)CCCOC1.
What is the InChIKey of [3-[3-(2,2,2-trifluoroethoxy)propyl]oxan-3-yl]methanol?
The InChIKey is SQLSCUHXQGJFPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3O3/c12-11(13,14)9-17-6-2-4-10(7-15)3-1-5-16-8-10/h15H,1-9H2.
What are the key properties of [3-[3-(2,2,2-trifluoroethoxy)propyl]oxan-3-yl]methanol?
[3-[3-(2,2,2-trifluoroethoxy)propyl]oxan-3-yl]methanol has a molecular weight of 256.26 g/mol, XLogP of 2.13, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[3-(2,2,2-trifluoroethoxy)propyl]oxan-3-yl]methanol is sourced from PubChem (CID 66059231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).