About 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]pentan-1-ol
4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]pentan-1-ol (PubChem CID 66060461) has the molecular formula C11H19NOS
and a molecular weight of 213.35 g/mol. Its IUPAC name is 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]pentan-1-ol.
Molecular Properties
| Compound Name | 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]pentan-1-ol |
| PubChem CID | 66060461 |
| Molecular Formula | C11H19NOS |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]pentan-1-ol |
| SMILES | Cc1ncc(CC(CO)CC(C)C)s1 |
| InChI | InChI=1S/C11H19NOS/c1-8(2)4-10(7-13)5-11-6-12-9(3)14-11/h6,8,10,13H,4-5,7H2,1-3H3 |
| InChIKey | NJHFSALANBMCET-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]pentan-1-ol?
The IUPAC name of 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]pentan-1-ol (CID 66060461) is 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]pentan-1-ol.
What is the SMILES notation for 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]pentan-1-ol?
The canonical SMILES for 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]pentan-1-ol is Cc1ncc(CC(CO)CC(C)C)s1.
What is the InChIKey of 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]pentan-1-ol?
The InChIKey is NJHFSALANBMCET-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NOS/c1-8(2)4-10(7-13)5-11-6-12-9(3)14-11/h6,8,10,13H,4-5,7H2,1-3H3.
What are the key properties of 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]pentan-1-ol?
4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]pentan-1-ol has a molecular weight of 213.35 g/mol, XLogP of 2.65, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-[(2-methyl-1,3-thiazol-5-yl)methyl]pentan-1-ol is sourced from PubChem (CID 66060461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).