C8H12N2O3 — CID 66060825
3-(2-methyl-3,5-dioxopiperazin-1-yl)propanal (PubChem CID 66060825) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is 3-(2-methyl-3,5-dioxopiperazin-1-yl)propanal.
| Compound Name | 3-(2-methyl-3,5-dioxopiperazin-1-yl)propanal |
|---|---|
| PubChem CID | 66060825 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 3-(2-methyl-3,5-dioxopiperazin-1-yl)propanal |
| SMILES | CC1C(=O)NC(=O)CN1CCC=O |
| InChI | InChI=1S/C8H12N2O3/c1-6-8(13)9-7(12)5-10(6)3-2-4-11/h4,6H,2-3,5H2,1H3,(H,9,12,13) |
| InChIKey | LPIJSVJXTANQOO-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|