C11H13ClN4O2 — CID 66061062
4-(6-chloro-5-propylpyrimidin-4-yl)piperazine-2,6-dione (PubChem CID 66061062) has the molecular formula C11H13ClN4O2 and a molecular weight of 268.70 g/mol. Its IUPAC name is 4-(6-chloro-5-propylpyrimidin-4-yl)piperazine-2,6-dione.
| Compound Name | 4-(6-chloro-5-propylpyrimidin-4-yl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66061062 |
| Molecular Formula | C11H13ClN4O2 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 4-(6-chloro-5-propylpyrimidin-4-yl)piperazine-2,6-dione |
| SMILES | CCCc1c(Cl)ncnc1N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C11H13ClN4O2/c1-2-3-7-10(12)13-6-14-11(7)16-4-8(17)15-9(18)5-16/h6H,2-5H2,1H3,(H,15,17,18) |
| InChIKey | WMGOTIJLCMTQPX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|