C10H10N4O5 — CID 66061161
5-(2-methyl-3,5-dioxopiperazine-1-carbonyl)-1H-pyrimidine-2,4-dione (PubChem CID 66061161) has the molecular formula C10H10N4O5 and a molecular weight of 266.21 g/mol. Its IUPAC name is 5-(2-methyl-3,5-dioxopiperazine-1-carbonyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(2-methyl-3,5-dioxopiperazine-1-carbonyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66061161 |
| Molecular Formula | C10H10N4O5 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 5-(2-methyl-3,5-dioxopiperazine-1-carbonyl)-1H-pyrimidine-2,4-dione |
| SMILES | CC1C(=O)NC(=O)CN1C(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H10N4O5/c1-4-7(16)12-6(15)3-14(4)9(18)5-2-11-10(19)13-8(5)17/h2,4H,3H2,1H3,(H,12,15,16)(H2,11,13,17,19) |
| InChIKey | SKZFKXWZNQZKEC-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 132.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|