C13H17N3O4S — CID 66061341
4-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetyl]-3-methylpiperazine-2,6-dione (PubChem CID 66061341) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 4-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetyl]-3-methylpiperazine-2,6-dione.
| Compound Name | 4-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetyl]-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66061341 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 4-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetyl]-3-methylpiperazine-2,6-dione |
| SMILES | Cc1noc(C)c1CSCC(=O)N1CC(=O)NC(=O)C1C |
| InChI | InChI=1S/C13H17N3O4S/c1-7-10(9(3)20-15-7)5-21-6-12(18)16-4-11(17)14-13(19)8(16)2/h8H,4-6H2,1-3H3,(H,14,17,19) |
| InChIKey | FASQESJTDZBMCX-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|